C19H21Cl2N3O2 — CID 136612152
3-(aminomethyl)-4-(2,4-dichlorophenyl)-6-(3-methoxypropyl)-2-methylpyrrolo[3,4-b]pyridin-5-ol (PubChem CID 136612152) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 3-(aminomethyl)-4-(2,4-dichlorophenyl)-6-(3-methoxypropyl)-2-methylpyrrolo[3,4-b]pyridin-5-ol.
| Compound Name | 3-(aminomethyl)-4-(2,4-dichlorophenyl)-6-(3-methoxypropyl)-2-methylpyrrolo[3,4-b]pyridin-5-ol |
|---|---|
| PubChem CID | 136612152 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-(aminomethyl)-4-(2,4-dichlorophenyl)-6-(3-methoxypropyl)-2-methylpyrrolo[3,4-b]pyridin-5-ol |
| SMILES | COCCCn1cc2nc(C)c(CN)c(-c3ccc(Cl)cc3Cl)c2c1O |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-11-14(9-22)17(13-5-4-12(20)8-15(13)21)18-16(23-11)10-24(19(18)25)6-3-7-26-2/h4-5,8,10,25H,3,6-7,9,22H2,1-2H3 |
| InChIKey | YJMZCYHYNCJUGF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|