C9H7N4O+ — CID 136612285
4,6,8-triaza-12-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-3-one (PubChem CID 136612285) has the molecular formula C9H7N4O+ and a molecular weight of 187.18 g/mol. Its IUPAC name is 4,6,8-triaza-12-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-3-one.
| Compound Name | 4,6,8-triaza-12-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-3-one |
|---|---|
| PubChem CID | 136612285 |
| Molecular Formula | C9H7N4O+ |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 4,6,8-triaza-12-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-3-one |
| SMILES | O=c1[nH]cnc2[nH]c3cc[nH+]cc3c12 |
| InChI | InChI=1S/C9H6N4O/c14-9-7-5-3-10-2-1-6(5)13-8(7)11-4-12-9/h1-4H,(H2,11,12,13,14)/p+1 |
| InChIKey | BAJXYDLTYSCAOF-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |