C24H28N4 — CID 136612604
(2E,7Z,11Z,16Z)-2,7,12,17-tetramethyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),16-octaene (PubChem CID 136612604) has the molecular formula C24H28N4 and a molecular weight of 372.52 g/mol. Its IUPAC name is (2E,7Z,11Z,16Z)-2,7,12,17-tetramethyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),16-octaene.
| Compound Name | (2E,7Z,11Z,16Z)-2,7,12,17-tetramethyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),16-octaene |
|---|---|
| PubChem CID | 136612604 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2E,7Z,11Z,16Z)-2,7,12,17-tetramethyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),16-octaene |
| SMILES | C/C1=C2\CCC(=N2)/C(C)=c2/cc/c([nH]2)=C(\C)C2=C/C(=C(/C)C3=CCC1N3)NC2 |
| InChI | InChI=1S/C24H28N4/c1-13-17-11-24(25-12-17)16(4)23-10-9-22(28-23)15(3)21-8-7-20(27-21)14(2)19-6-5-18(13)26-19/h5-6,10-11,22,25-26,28H,7-9,12H2,1-4H3/b18-13-,19-14-,21-15-,24-16+ |
| InChIKey | KDPFSGVQYKMZER-LEMLIXGMSA-N |
| XLogP | 2.93 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |