C25H26F3N3O2 — CID 136612816
2-[1-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl]indol-5-yl]propanenitrile (PubChem CID 136612816) has the molecular formula C25H26F3N3O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-[1-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl]indol-5-yl]propanenitrile.
| Compound Name | 2-[1-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl]indol-5-yl]propanenitrile |
|---|---|
| PubChem CID | 136612816 |
| Molecular Formula | C25H26F3N3O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-[1-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl]indol-5-yl]propanenitrile |
| SMILES | [H]/N=C(/c1ccc(OCCCn2ccc3cc(C(C)C#N)ccc32)c(CCC)c1O)C(F)(F)F |
| InChI | InChI=1S/C25H26F3N3O2/c1-3-5-19-22(9-7-20(23(19)32)24(30)25(26,27)28)33-13-4-11-31-12-10-18-14-17(16(2)15-29)6-8-21(18)31/h6-10,12,14,16,30,32H,3-5,11,13H2,1-2H3/b30-24- |
| InChIKey | RGRZYBAVBUAALP-KRUMMXJUSA-N |
| XLogP | 6.33 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|