C22H22FN5O2 — CID 136612903
2-[9-(4-fluoro-2-methylphenyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-c][1,4]oxazepin-2-yl]-4-methoxy-1H-indol-5-amine (PubChem CID 136612903) has the molecular formula C22H22FN5O2 and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-[9-(4-fluoro-2-methylphenyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-c][1,4]oxazepin-2-yl]-4-methoxy-1H-indol-5-amine.
| Compound Name | 2-[9-(4-fluoro-2-methylphenyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-c][1,4]oxazepin-2-yl]-4-methoxy-1H-indol-5-amine |
|---|---|
| PubChem CID | 136612903 |
| Molecular Formula | C22H22FN5O2 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[9-(4-fluoro-2-methylphenyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-c][1,4]oxazepin-2-yl]-4-methoxy-1H-indol-5-amine |
| SMILES | COc1c(N)ccc2[nH]c(-c3nc4n(n3)CCCOC4c3ccc(F)cc3C)cc12 |
| InChI | InChI=1S/C22H22FN5O2/c1-12-10-13(23)4-5-14(12)20-22-26-21(27-28(22)8-3-9-30-20)18-11-15-17(25-18)7-6-16(24)19(15)29-2/h4-7,10-11,20,25H,3,8-9,24H2,1-2H3 |
| InChIKey | VECBPAKELQPHIH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|