C30H32F4N6O — CID 136613657
3-[6-[1-[[(3Z,5Z)-5,7-diamino-4-[(Z)-prop-1-enyl]-7-(3,3,3-trifluoroprop-1-en-2-ylimino)hepta-1,3,5-trien-3-yl]amino]ethenyl]-2-pyridinyl]-4-fluoro-N-propan-2-ylbenzamide (PubChem CID 136613657) has the molecular formula C30H32F4N6O and a molecular weight of 568.62 g/mol. Its IUPAC name is 3-[6-[1-[[(3Z,5Z)-5,7-diamino-4-[(Z)-prop-1-enyl]-7-(3,3,3-trifluoroprop-1-en-2-ylimino)hepta-1,3,5-trien-3-yl]amino]ethenyl]-2-pyridinyl]-4-fluoro-N-propan-2-ylbenzamide.
| Compound Name | 3-[6-[1-[[(3Z,5Z)-5,7-diamino-4-[(Z)-prop-1-enyl]-7-(3,3,3-trifluoroprop-1-en-2-ylimino)hepta-1,3,5-trien-3-yl]amino]ethenyl]-2-pyridinyl]-4-fluoro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 136613657 |
| Molecular Formula | C30H32F4N6O |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 3-[6-[1-[[(3Z,5Z)-5,7-diamino-4-[(Z)-prop-1-enyl]-7-(3,3,3-trifluoroprop-1-en-2-ylimino)hepta-1,3,5-trien-3-yl]amino]ethenyl]-2-pyridinyl]-4-fluoro-N-propan-2-ylbenzamide |
| SMILES | C=C/C(NC(=C)c1cccc(-c2cc(C(=O)NC(C)C)ccc2F)n1)=C(\C=C/C)C(/N)=C/C(N)=N/C(=C)C(F)(F)F |
| InChI | InChI=1S/C30H32F4N6O/c1-7-10-21(24(35)16-28(36)39-19(6)30(32,33)34)25(8-2)38-18(5)26-11-9-12-27(40-26)22-15-20(13-14-23(22)31)29(41)37-17(3)4/h7-17,38H,2,5-6,35H2,1,3-4H3,(H2,36,39)(H,37,41)/b10-7-,24-16-,25-21- |
| InChIKey | CXBZCUKGTPEISY-FWWFHWIKSA-N |
| XLogP | 5.88 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|