About CID 136613771
CID 136613771 (PubChem CID 136613771) has the molecular formula C22H25BN6O5S
and a molecular weight of 496.36 g/mol.
Molecular Properties
| Compound Name | CID 136613771 |
| PubChem CID | 136613771 |
| Molecular Formula | C22H25BN6O5S |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | — |
| SMILES | [H]/N=c1\ncn(CCC2CCN(C(=O)[C@@H](O)CO)CC2)c2nc(Sc3cc4c(cc3[B])OCO4)[nH]c12 |
| InChI | InChI=1S/C22H25BN6O5S/c23-13-7-15-16(34-11-33-15)8-17(13)35-22-26-18-19(24)25-10-29(20(18)27-22)6-3-12-1-4-28(5-2-12)21(32)14(31)9-30/h7-8,10,12,14,24,30-31H,1-6,9,11H2,(H,26,27)/b24-19-/t14-/m0/s1 |
| InChIKey | GZVHESJXJRABIX-WUXPNXBRSA-N |
| XLogP | -0.11 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136613771 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136613771?
The IUPAC name of CID 136613771 (CID 136613771) is not available.
What is the SMILES notation for CID 136613771?
The canonical SMILES for CID 136613771 is [H]/N=c1\ncn(CCC2CCN(C(=O)[C@@H](O)CO)CC2)c2nc(Sc3cc4c(cc3[B])OCO4)[nH]c12.
What is the InChIKey of CID 136613771?
The InChIKey is GZVHESJXJRABIX-WUXPNXBRSA-N. The full InChI is InChI=1S/C22H25BN6O5S/c23-13-7-15-16(34-11-33-15)8-17(13)35-22-26-18-19(24)25-10-29(20(18)27-22)6-3-12-1-4-28(5-2-12)21(32)14(31)9-30/h7-8,10,12,14,24,30-31H,1-6,9,11H2,(H,26,27)/b24-19-/t14-/m0/s1.
What are the key properties of CID 136613771?
CID 136613771 has a molecular weight of 496.36 g/mol, XLogP of -0.11, 7 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136613771 is sourced from PubChem (CID 136613771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).