C36H30N2O2 — CID 136614101
1-[1-[(Z)-(3-anthracen-9-yl-2-hydroxyphenyl)methylideneamino]-5-(2,4-dimethylphenyl)-2-methylpyrrol-3-yl]ethanone (PubChem CID 136614101) has the molecular formula C36H30N2O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 1-[1-[(Z)-(3-anthracen-9-yl-2-hydroxyphenyl)methylideneamino]-5-(2,4-dimethylphenyl)-2-methylpyrrol-3-yl]ethanone.
| Compound Name | 1-[1-[(Z)-(3-anthracen-9-yl-2-hydroxyphenyl)methylideneamino]-5-(2,4-dimethylphenyl)-2-methylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 136614101 |
| Molecular Formula | C36H30N2O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 1-[1-[(Z)-(3-anthracen-9-yl-2-hydroxyphenyl)methylideneamino]-5-(2,4-dimethylphenyl)-2-methylpyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccc(C)cc2C)n(/N=C\c2cccc(-c3c4ccccc4cc4ccccc34)c2O)c1C |
| InChI | InChI=1S/C36H30N2O2/c1-22-16-17-29(23(2)18-22)34-20-33(25(4)39)24(3)38(34)37-21-28-12-9-15-32(36(28)40)35-30-13-7-5-10-26(30)19-27-11-6-8-14-31(27)35/h5-21,40H,1-4H3/b37-21- |
| InChIKey | QCEJDJJLCKJQAQ-DBSPGSINSA-N |
| XLogP | 8.84 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|