C8H11N9OS2 — CID 136614384
2,4-diamino-5-[[5-[methyl(sulfanylmethyl)amino]-1,3,4-thiadiazol-2-yl]diazenyl]-1H-pyrimidin-6-one (PubChem CID 136614384) has the molecular formula C8H11N9OS2 and a molecular weight of 313.37 g/mol. Its IUPAC name is 2,4-diamino-5-[[5-[methyl(sulfanylmethyl)amino]-1,3,4-thiadiazol-2-yl]diazenyl]-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-[[5-[methyl(sulfanylmethyl)amino]-1,3,4-thiadiazol-2-yl]diazenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136614384 |
| Molecular Formula | C8H11N9OS2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2,4-diamino-5-[[5-[methyl(sulfanylmethyl)amino]-1,3,4-thiadiazol-2-yl]diazenyl]-1H-pyrimidin-6-one |
| SMILES | CN(CS)c1nnc(/N=N/c2c(N)nc(N)[nH]c2=O)s1 |
| InChI | InChI=1S/C8H11N9OS2/c1-17(2-19)8-16-15-7(20-8)14-13-3-4(9)11-6(10)12-5(3)18/h19H,2H2,1H3,(H5,9,10,11,12,18)/b14-13+ |
| InChIKey | FZQYZBWXKGHQHR-BUHFOSPRSA-N |
| XLogP | 0.52 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|