C21H21ClN10O — CID 136614422
1-(6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-[(Z)-N-(methylideneamino)carbamohydrazonoyl]urea (PubChem CID 136614422) has the molecular formula C21H21ClN10O and a molecular weight of 464.92 g/mol. Its IUPAC name is 1-(6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-[(Z)-N-(methylideneamino)carbamohydrazonoyl]urea.
| Compound Name | 1-(6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-[(Z)-N-(methylideneamino)carbamohydrazonoyl]urea |
|---|---|
| PubChem CID | 136614422 |
| Molecular Formula | C21H21ClN10O |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-(6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-[(Z)-N-(methylideneamino)carbamohydrazonoyl]urea |
| SMILES | C=NN/C(=N\N)NC(=O)Nc1ccc2cc1CCc1cccc(c1)Nc1ncc(Cl)c(n1)N2 |
| InChI | InChI=1S/C21H21ClN10O/c1-24-32-20(31-23)30-21(33)28-17-8-7-15-10-13(17)6-5-12-3-2-4-14(9-12)27-19-25-11-16(22)18(26-15)29-19/h2-4,7-11H,1,5-6,23H2,(H2,25,26,27,29)(H3,28,30,31,32,33) |
| InChIKey | DAHNKQQAYXYVEW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|