C16H16N4OS — CID 136614767
N-methyl-5-(3-methyl-4-pyridin-2-yloxyphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 136614767) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-methyl-5-(3-methyl-4-pyridin-2-yloxyphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-methyl-5-(3-methyl-4-pyridin-2-yloxyphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 136614767 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-methyl-5-(3-methyl-4-pyridin-2-yloxyphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | C/N=C1/NN=C(c2ccc(Oc3ccccn3)c(C)c2)CS1 |
| InChI | InChI=1S/C16H16N4OS/c1-11-9-12(13-10-22-16(17-2)20-19-13)6-7-14(11)21-15-5-3-4-8-18-15/h3-9H,10H2,1-2H3,(H,17,20) |
| InChIKey | LQHQOCQEDKGDAG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|