C17H17N5O5 — CID 136615040
ethyl 2-[[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-(furan-2-yl)pyrazol-5-yl]amino]-2-oxoacetate (PubChem CID 136615040) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is ethyl 2-[[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-(furan-2-yl)pyrazol-5-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-(furan-2-yl)pyrazol-5-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 136615040 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl 2-[[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-(furan-2-yl)pyrazol-5-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(-c2ccco2)nn1-c1nc(C)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17N5O5/c1-4-26-16(25)15(24)19-13-8-11(12-6-5-7-27-12)21-22(13)17-18-10(3)9(2)14(23)20-17/h5-8H,4H2,1-3H3,(H,19,24)(H,18,20,23) |
| InChIKey | SRKQRMNWUMUGQE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|