C25H21N3O3S — CID 136615688
2-(2-benzylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-N-(4-phenoxyphenyl)acetamide (PubChem CID 136615688) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-(2-benzylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-(2-benzylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 136615688 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-(2-benzylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(Cc1cc(=O)[nH]c(SCc2ccccc2)n1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c29-23(26-19-11-13-22(14-12-19)31-21-9-5-2-6-10-21)15-20-16-24(30)28-25(27-20)32-17-18-7-3-1-4-8-18/h1-14,16H,15,17H2,(H,26,29)(H,27,28,30) |
| InChIKey | FVCPOJWGUIWARF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |