C20H25N3O3S — CID 136615890
N-cyclohexyl-2-[2-[(3-methoxyphenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetamide (PubChem CID 136615890) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-[(3-methoxyphenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[2-[(3-methoxyphenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 136615890 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-cyclohexyl-2-[2-[(3-methoxyphenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetamide |
| SMILES | COc1cccc(CSc2nc(CC(=O)NC3CCCCC3)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C20H25N3O3S/c1-26-17-9-5-6-14(10-17)13-27-20-22-16(12-19(25)23-20)11-18(24)21-15-7-3-2-4-8-15/h5-6,9-10,12,15H,2-4,7-8,11,13H2,1H3,(H,21,24)(H,22,23,25) |
| InChIKey | CXFQPJRYGWRONX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |