C22H21N3O2S — CID 136616823
N-benzyl-2-[6-oxo-2-[(E)-3-phenylprop-2-enyl]sulfanyl-1H-pyrimidin-4-yl]acetamide (PubChem CID 136616823) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is N-benzyl-2-[6-oxo-2-[(E)-3-phenylprop-2-enyl]sulfanyl-1H-pyrimidin-4-yl]acetamide.
| Compound Name | N-benzyl-2-[6-oxo-2-[(E)-3-phenylprop-2-enyl]sulfanyl-1H-pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 136616823 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-benzyl-2-[6-oxo-2-[(E)-3-phenylprop-2-enyl]sulfanyl-1H-pyrimidin-4-yl]acetamide |
| SMILES | O=C(Cc1cc(=O)[nH]c(SC/C=C/c2ccccc2)n1)NCc1ccccc1 |
| InChI | InChI=1S/C22H21N3O2S/c26-20(23-16-18-10-5-2-6-11-18)14-19-15-21(27)25-22(24-19)28-13-7-12-17-8-3-1-4-9-17/h1-12,15H,13-14,16H2,(H,23,26)(H,24,25,27)/b12-7+ |
| InChIKey | VLRJTQHPUCBBRU-KPKJPENVSA-N |
| XLogP | 3.43 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |