About 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole
3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole (PubChem CID 136617451) has the molecular formula C17H16N4OS
and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole.
Molecular Properties
| Compound Name | 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole |
| PubChem CID | 136617451 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole |
| SMILES | CC[C@@](C)(N=O)c1ccc2[nH]c(-c3n[nH]c4ccsc34)cc2c1 |
| InChI | InChI=1S/C17H16N4OS/c1-3-17(2,21-22)11-4-5-12-10(8-11)9-14(18-12)15-16-13(19-20-15)6-7-23-16/h4-9,18H,3H2,1-2H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | GRGZPUMVWWXNSL-QGZVFWFLSA-N |
| XLogP | 5.16 |
| TPSA | 73.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole?
The IUPAC name of 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole (CID 136617451) is 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole.
What is the SMILES notation for 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole?
The canonical SMILES for 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole is CC[C@@](C)(N=O)c1ccc2[nH]c(-c3n[nH]c4ccsc34)cc2c1.
What is the InChIKey of 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole?
The InChIKey is GRGZPUMVWWXNSL-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H16N4OS/c1-3-17(2,21-22)11-4-5-12-10(8-11)9-14(18-12)15-16-13(19-20-15)6-7-23-16/h4-9,18H,3H2,1-2H3,(H,19,20)/t17-/m1/s1.
What are the key properties of 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole?
3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole has a molecular weight of 324.41 g/mol, XLogP of 5.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(2R)-2-nitrosobutan-2-yl]-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole is sourced from PubChem (CID 136617451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).