C32H33BFN5O7S — CID 136617620
CID 136617620 (PubChem CID 136617620) has the molecular formula C32H33BFN5O7S and a molecular weight of 661.52 g/mol.
| Compound Name | CID 136617620 |
|---|---|
| PubChem CID | 136617620 |
| Molecular Formula | C32H33BFN5O7S |
| Molecular Weight | 661.52 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | — |
| SMILES | [B]N(C)Cc1cc(NC(=O)OCCc2c(C)cc(C(Nc3cc4c(=O)[nH]cnc4cc3F)C(=O)O)cc2C)ccc1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C32H33BFN5O7S/c1-17-10-19(29(31(41)42)38-27-13-24-26(14-25(27)34)35-16-36-30(24)40)11-18(2)23(17)8-9-46-32(43)37-21-4-7-28(20(12-21)15-39(3)33)47(44,45)22-5-6-22/h4,7,10-14,16,22,29,38H,5-6,8-9,15H2,1-3H3,(H,37,43)(H,41,42)(H,35,36,40) |
| InChIKey | KCEYESPBOZSBGB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 170.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|