About CID 136617620
CID 136617620 (PubChem CID 136617620) has the molecular formula C32H33BFN5O7S
and a molecular weight of 661.52 g/mol.
Molecular Properties
| Compound Name | CID 136617620 |
| PubChem CID | 136617620 |
| Molecular Formula | C32H33BFN5O7S |
| Molecular Weight | 661.52 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | — |
| SMILES | [B]N(C)Cc1cc(NC(=O)OCCc2c(C)cc(C(Nc3cc4c(=O)[nH]cnc4cc3F)C(=O)O)cc2C)ccc1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C32H33BFN5O7S/c1-17-10-19(29(31(41)42)38-27-13-24-26(14-25(27)34)35-16-36-30(24)40)11-18(2)23(17)8-9-46-32(43)37-21-4-7-28(20(12-21)15-39(3)33)47(44,45)22-5-6-22/h4,7,10-14,16,22,29,38H,5-6,8-9,15H2,1-3H3,(H,37,43)(H,41,42)(H,35,36,40) |
| InChIKey | KCEYESPBOZSBGB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 170.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 661.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136617620 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136617620?
The IUPAC name of CID 136617620 (CID 136617620) is not available.
What is the SMILES notation for CID 136617620?
The canonical SMILES for CID 136617620 is [B]N(C)Cc1cc(NC(=O)OCCc2c(C)cc(C(Nc3cc4c(=O)[nH]cnc4cc3F)C(=O)O)cc2C)ccc1S(=O)(=O)C1CC1.
What is the InChIKey of CID 136617620?
The InChIKey is KCEYESPBOZSBGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H33BFN5O7S/c1-17-10-19(29(31(41)42)38-27-13-24-26(14-25(27)34)35-16-36-30(24)40)11-18(2)23(17)8-9-46-32(43)37-21-4-7-28(20(12-21)15-39(3)33)47(44,45)22-5-6-22/h4,7,10-14,16,22,29,38H,5-6,8-9,15H2,1-3H3,(H,37,43)(H,41,42)(H,35,36,40).
What are the key properties of CID 136617620?
CID 136617620 has a molecular weight of 661.52 g/mol, XLogP of 4.16, 12 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136617620 is sourced from PubChem (CID 136617620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).