C12H12FN5O3 — CID 136619250
3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136619250) has the molecular formula C12H12FN5O3 and a molecular weight of 293.26 g/mol. Its IUPAC name is 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136619250 |
| Molecular Formula | C12H12FN5O3 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CO[C@H](c1ccc(-c2noc(=O)[nH]2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C12H12FN5O3/c1-20-10(9(6-13)16-18-14)7-2-4-8(5-3-7)11-15-12(19)21-17-11/h2-5,9-10H,6H2,1H3,(H,15,17,19)/t9-,10-/m1/s1 |
| InChIKey | LTECOGYADOZNFP-NXEZZACHSA-N |
| XLogP | 2.37 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|