C42H37N3O5 — CID 136619409
2-(4-cyclohexyl-2-cyclopenta-1,3-dien-1-ylphenyl)-6-[7-[(Z)-hex-2-en-2-yl]-4-oxo-3H-quinazolin-2-yl]cyclopenta[f]isoindole-1,3,5,7-tetrone (PubChem CID 136619409) has the molecular formula C42H37N3O5 and a molecular weight of 663.77 g/mol. Its IUPAC name is 2-(4-cyclohexyl-2-cyclopenta-1,3-dien-1-ylphenyl)-6-[7-[(Z)-hex-2-en-2-yl]-4-oxo-3H-quinazolin-2-yl]cyclopenta[f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-(4-cyclohexyl-2-cyclopenta-1,3-dien-1-ylphenyl)-6-[7-[(Z)-hex-2-en-2-yl]-4-oxo-3H-quinazolin-2-yl]cyclopenta[f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 136619409 |
| Molecular Formula | C42H37N3O5 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | 2-(4-cyclohexyl-2-cyclopenta-1,3-dien-1-ylphenyl)-6-[7-[(Z)-hex-2-en-2-yl]-4-oxo-3H-quinazolin-2-yl]cyclopenta[f]isoindole-1,3,5,7-tetrone |
| SMILES | CCC/C=C(/C)c1ccc2c(=O)[nH]c(C3C(=O)c4cc5c(cc4C3=O)C(=O)N(c3ccc(C4CCCCC4)cc3C3=CC=CC3)C5=O)nc2c1 |
| InChI | InChI=1S/C42H37N3O5/c1-3-4-10-23(2)26-15-17-28-34(20-26)43-39(44-40(28)48)36-37(46)30-21-32-33(22-31(30)38(36)47)42(50)45(41(32)49)35-18-16-27(24-11-6-5-7-12-24)19-29(35)25-13-8-9-14-25/h8-10,13,15-22,24,36H,3-7,11-12,14H2,1-2H3,(H,43,44,48)/b23-10- |
| InChIKey | DYLCHBUXKSWZNR-RMORIDSASA-N |
| XLogP | 8.48 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|