C9H9N3O3 — CID 136619501
6-(1-hydroxyethenyl)-5-methoxy-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 136619501) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 6-(1-hydroxyethenyl)-5-methoxy-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 6-(1-hydroxyethenyl)-5-methoxy-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 136619501 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 6-(1-hydroxyethenyl)-5-methoxy-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | C=C(O)c1cn2nc[nH]c(=O)c2c1OC |
| InChI | InChI=1S/C9H9N3O3/c1-5(13)6-3-12-7(8(6)15-2)9(14)10-4-11-12/h3-4,13H,1H2,2H3,(H,10,11,14) |
| InChIKey | SABRFHSKKKTCGW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|