C12H17N3O4 — CID 136619536
ethyl 2-[4-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-6-oxo-1H-pyrimidin-2-yl]acetate (PubChem CID 136619536) has the molecular formula C12H17N3O4 and a molecular weight of 275.33 g/mol. Its IUPAC name is ethyl 2-[4-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-6-oxo-1H-pyrimidin-2-yl]acetate.
| Compound Name | ethyl 2-[4-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-6-oxo-1H-pyrimidin-2-yl]acetate |
|---|---|
| PubChem CID | 136619536 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | ethyl 2-[4-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-6-oxo-1H-pyrimidin-2-yl]acetate |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(c2cc(=O)[nH]c(CC(=O)OCC)n2)C1([2H])[2H] |
| InChI | InChI=1S/C12H17N3O4/c1-2-19-12(17)7-9-13-10(8-11(16)14-9)15-3-5-18-6-4-15/h8H,2-7H2,1H3,(H,13,14,16)/i3D2,4D2,5D2,6D2 |
| InChIKey | KSZKVHPIAYRXAH-SQUIKQQTSA-N |
| XLogP | -0.29 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |