C10H13N3O4 — CID 136619537
2-[4-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-6-oxo-1H-pyrimidin-2-yl]acetic acid (PubChem CID 136619537) has the molecular formula C10H13N3O4 and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-[4-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-6-oxo-1H-pyrimidin-2-yl]acetic acid.
| Compound Name | 2-[4-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-6-oxo-1H-pyrimidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 136619537 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-[4-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-6-oxo-1H-pyrimidin-2-yl]acetic acid |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(c2cc(=O)[nH]c(CC(=O)O)n2)C1([2H])[2H] |
| InChI | InChI=1S/C10H13N3O4/c14-9-6-8(13-1-3-17-4-2-13)11-7(12-9)5-10(15)16/h6H,1-5H2,(H,15,16)(H,11,12,14)/i1D2,2D2,3D2,4D2 |
| InChIKey | KLCWILCHDGOMES-SVYQBANQSA-N |
| XLogP | -0.77 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |