About (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine
(E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine (PubChem CID 136619754) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine.
Molecular Properties
| Compound Name | (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine |
| PubChem CID | 136619754 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine |
| SMILES | CO/N=C1\CCNc2ccccc21 |
| InChI | InChI=1S/C10H12N2O/c1-13-12-10-6-7-11-9-5-3-2-4-8(9)10/h2-5,11H,6-7H2,1H3/b12-10+ |
| InChIKey | TUMUEURZPPBVKA-ZRDIBKRKSA-N |
| XLogP | 1.85 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine?
The IUPAC name of (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine (CID 136619754) is (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine.
What is the SMILES notation for (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine?
The canonical SMILES for (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine is CO/N=C1\CCNc2ccccc21.
What is the InChIKey of (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine?
The InChIKey is TUMUEURZPPBVKA-ZRDIBKRKSA-N. The full InChI is InChI=1S/C10H12N2O/c1-13-12-10-6-7-11-9-5-3-2-4-8(9)10/h2-5,11H,6-7H2,1H3/b12-10+.
What are the key properties of (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine?
(E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine has a molecular weight of 176.22 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methoxy-2,3-dihydro-1H-quinolin-4-imine is sourced from PubChem (CID 136619754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).