C17H18N6 — CID 136620741
6-[(3E,5Z)-4-aminohepta-1,3,5-trien-2-yl]-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine (PubChem CID 136620741) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 6-[(3E,5Z)-4-aminohepta-1,3,5-trien-2-yl]-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine.
| Compound Name | 6-[(3E,5Z)-4-aminohepta-1,3,5-trien-2-yl]-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
|---|---|
| PubChem CID | 136620741 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 6-[(3E,5Z)-4-aminohepta-1,3,5-trien-2-yl]-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
| SMILES | C=C(/C=C(N)\C=C/C)c1cc2[nH]c(N)nc(N)c2c2ccnc12 |
| InChI | InChI=1S/C17H18N6/c1-3-4-10(18)7-9(2)12-8-13-14(11-5-6-21-15(11)12)16(19)23-17(20)22-13/h3-8H,2,18-19H2,1H3,(H3,20,22,23)/b4-3-,10-7+ |
| InChIKey | HVVDTJLBHMUGGG-HQGAUJLMSA-N |
| XLogP | 2.71 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|