C15H24N6 — CID 136621012
5-(3-aminopropylimino)-N-(1-methylcyclopent-3-en-1-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 136621012) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 5-(3-aminopropylimino)-N-(1-methylcyclopent-3-en-1-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(3-aminopropylimino)-N-(1-methylcyclopent-3-en-1-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 136621012 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 5-(3-aminopropylimino)-N-(1-methylcyclopent-3-en-1-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC1(NC2C/C(=N/CCCN)Nc3ccnn32)CC=CC1 |
| InChI | InChI=1S/C15H24N6/c1-15(6-2-3-7-15)20-14-11-12(17-9-4-8-16)19-13-5-10-18-21(13)14/h2-3,5,10,14,20H,4,6-9,11,16H2,1H3,(H,17,19) |
| InChIKey | KYTKVWKDBJFSAP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|