C29H25FN4O2 — CID 136621664
3-[(E)-2-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2,3-dihydro-1H-indazol-5-yl)-2-phenylethenyl]phenyl]ethenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136621664) has the molecular formula C29H25FN4O2 and a molecular weight of 480.54 g/mol. Its IUPAC name is 3-[(E)-2-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2,3-dihydro-1H-indazol-5-yl)-2-phenylethenyl]phenyl]ethenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[(E)-2-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2,3-dihydro-1H-indazol-5-yl)-2-phenylethenyl]phenyl]ethenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136621664 |
| Molecular Formula | C29H25FN4O2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[(E)-2-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2,3-dihydro-1H-indazol-5-yl)-2-phenylethenyl]phenyl]ethenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=c1[nH]c(/C=C/c2ccc(/C(=C(\c3ccccc3)C3CCC3)c3ccc4c(c3)C(F)NN4)cc2)no1 |
| InChI | InChI=1S/C29H25FN4O2/c30-28-23-17-22(14-15-24(23)32-33-28)27(26(20-7-4-8-20)19-5-2-1-3-6-19)21-12-9-18(10-13-21)11-16-25-31-29(35)36-34-25/h1-3,5-6,9-17,20,28,32-33H,4,7-8H2,(H,31,34,35)/b16-11+,27-26- |
| InChIKey | DFRYIHSHDTVNPM-OMXZRZKWSA-N |
| XLogP | 6.19 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|