C22H24N4O4S — CID 136622302
6-[(2-cyclopropylimino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-[2-(2-methoxyethoxy)ethoxy]quinoline-3-carbonitrile (PubChem CID 136622302) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 6-[(2-cyclopropylimino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-[2-(2-methoxyethoxy)ethoxy]quinoline-3-carbonitrile.
| Compound Name | 6-[(2-cyclopropylimino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-[2-(2-methoxyethoxy)ethoxy]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 136622302 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 6-[(2-cyclopropylimino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-[2-(2-methoxyethoxy)ethoxy]quinoline-3-carbonitrile |
| SMILES | COCCOCCOc1c(C#N)cnc2ccc(C=S3CC(=O)N/C3=N\C3CC3)cc12 |
| InChI | InChI=1S/C22H24N4O4S/c1-28-6-7-29-8-9-30-21-16(11-23)12-24-19-5-2-15(10-18(19)21)13-31-14-20(27)26-22(31)25-17-3-4-17/h2,5,10,12-13,17H,3-4,6-9,14H2,1H3,(H,25,26,27) |
| InChIKey | SOBLCWPTTRAMOV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|