C32H23N7O6S — CID 136622478
3-[[4-hydroxy-6-[3-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 136622478) has the molecular formula C32H23N7O6S and a molecular weight of 633.65 g/mol. Its IUPAC name is 3-[[4-hydroxy-6-[3-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4-hydroxy-6-[3-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 136622478 |
| Molecular Formula | C32H23N7O6S |
| Molecular Weight | 633.65 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | 3-[[4-hydroxy-6-[3-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Cn1c(=O)cc2c3c(c(Nc4cccc(Nc5nc(O)nc(Nc6cccc(S(=O)(=O)O)c6)n5)c4)ccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C32H23N7O6S/c1-39-25-13-12-24(28-27(25)23(16-26(39)40)21-10-2-3-11-22(21)29(28)41)33-17-6-4-7-18(14-17)34-30-36-31(38-32(42)37-30)35-19-8-5-9-20(15-19)46(43,44)45/h2-16,33H,1H3,(H,43,44,45)(H3,34,35,36,37,38,42) |
| InChIKey | NUSZRTUMYSZSJO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 188.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|