C26H6Cl8N2O7S — CID 136622495
8-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)-2-(4,5,6,7-tetrachloro-1-hydroxy-3-oxoinden-2-yl)quinoline-6-sulfonic acid (PubChem CID 136622495) has the molecular formula C26H6Cl8N2O7S and a molecular weight of 774.03 g/mol. Its IUPAC name is 8-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)-2-(4,5,6,7-tetrachloro-1-hydroxy-3-oxoinden-2-yl)quinoline-6-sulfonic acid.
| Compound Name | 8-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)-2-(4,5,6,7-tetrachloro-1-hydroxy-3-oxoinden-2-yl)quinoline-6-sulfonic acid |
|---|---|
| PubChem CID | 136622495 |
| Molecular Formula | C26H6Cl8N2O7S |
| Molecular Weight | 774.03 g/mol |
| Exact Mass | 769.74 |
| IUPAC Name | 8-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)-2-(4,5,6,7-tetrachloro-1-hydroxy-3-oxoinden-2-yl)quinoline-6-sulfonic acid |
| SMILES | O=C1C(c2ccc3cc(S(=O)(=O)O)cc(N4C(=O)c5c(Cl)c(Cl)c(Cl)c(Cl)c5C4=O)c3n2)=C(O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
| InChI | InChI=1S/C26H6Cl8N2O7S/c27-14-10-11(15(28)19(32)18(14)31)24(38)9(23(10)37)7-2-1-5-3-6(44(41,42)43)4-8(22(5)35-7)36-25(39)12-13(26(36)40)17(30)21(34)20(33)16(12)29/h1-4,37H,(H,41,42,43) |
| InChIKey | CROVGQLQGQTLEN-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.03 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|