C18H17ClN6 — CID 136623025
(Z)-3-[5-[(3-aminophenyl)methyl]-1H-1,2,4-triazol-3-yl]-N'-(3-chlorophenyl)prop-2-enimidamide (PubChem CID 136623025) has the molecular formula C18H17ClN6 and a molecular weight of 352.83 g/mol. Its IUPAC name is (Z)-3-[5-[(3-aminophenyl)methyl]-1H-1,2,4-triazol-3-yl]-N'-(3-chlorophenyl)prop-2-enimidamide.
| Compound Name | (Z)-3-[5-[(3-aminophenyl)methyl]-1H-1,2,4-triazol-3-yl]-N'-(3-chlorophenyl)prop-2-enimidamide |
|---|---|
| PubChem CID | 136623025 |
| Molecular Formula | C18H17ClN6 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (Z)-3-[5-[(3-aminophenyl)methyl]-1H-1,2,4-triazol-3-yl]-N'-(3-chlorophenyl)prop-2-enimidamide |
| SMILES | NC(/C=C\c1n[nH]c(Cc2cccc(N)c2)n1)=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN6/c19-13-4-2-6-15(11-13)22-16(21)7-8-17-23-18(25-24-17)10-12-3-1-5-14(20)9-12/h1-9,11H,10,20H2,(H2,21,22)(H,23,24,25)/b8-7- |
| InChIKey | XWOYPLLIETXPHQ-FPLPWBNLSA-N |
| XLogP | 3.33 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|