About [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea
[(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea (PubChem CID 136623139) has the molecular formula C9H13N5O4
and a molecular weight of 255.23 g/mol. Its IUPAC name is [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea.
Molecular Properties
| Compound Name | [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea |
| PubChem CID | 136623139 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea |
| SMILES | C/C(=N/NC(N)=O)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H13N5O4/c1-4(11-12-8(10)17)5-6(15)13(2)9(18)14(3)7(5)16/h15H,1-3H3,(H3,10,12,17)/b11-4- |
| InChIKey | JJTSXXJQUGTPQV-WCIBSUBMSA-N |
| XLogP | -1.82 |
| TPSA | 131.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea?
The IUPAC name of [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea (CID 136623139) is [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea.
What is the SMILES notation for [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea?
The canonical SMILES for [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea is C/C(=N/NC(N)=O)c1c(O)n(C)c(=O)n(C)c1=O.
What is the InChIKey of [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea?
The InChIKey is JJTSXXJQUGTPQV-WCIBSUBMSA-N. The full InChI is InChI=1S/C9H13N5O4/c1-4(11-12-8(10)17)5-6(15)13(2)9(18)14(3)7(5)16/h15H,1-3H3,(H3,10,12,17)/b11-4-.
What are the key properties of [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea?
[(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea has a molecular weight of 255.23 g/mol, XLogP of -1.82, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]urea is sourced from PubChem (CID 136623139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).