C24H32N5O5S- — CID 136623366
4-[2-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,3-d]pyrimidin-2-yl)-N-sulfinatoanilino]ethyl]morpholine (PubChem CID 136623366) has the molecular formula C24H32N5O5S- and a molecular weight of 502.62 g/mol. Its IUPAC name is 4-[2-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,3-d]pyrimidin-2-yl)-N-sulfinatoanilino]ethyl]morpholine.
| Compound Name | 4-[2-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,3-d]pyrimidin-2-yl)-N-sulfinatoanilino]ethyl]morpholine |
|---|---|
| PubChem CID | 136623366 |
| Molecular Formula | C24H32N5O5S- |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 4-[2-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,3-d]pyrimidin-2-yl)-N-sulfinatoanilino]ethyl]morpholine |
| SMILES | CCCn1cc(C)c2c(=O)[nH]c(-c3cc(N(CCN4CCOCC4)S(=O)[O-])ccc3OCC)nc21 |
| InChI | InChI=1S/C24H33N5O5S/c1-4-8-28-16-17(3)21-23(28)25-22(26-24(21)30)19-15-18(6-7-20(19)34-5-2)29(35(31)32)10-9-27-11-13-33-14-12-27/h6-7,15-16H,4-5,8-14H2,1-3H3,(H,31,32)(H,25,26,30)/p-1 |
| InChIKey | VDYPRHGOPIVVSW-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 115.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|