About 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one
2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one (PubChem CID 136623433) has the molecular formula C12H8ClN3OS2
and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one |
| PubChem CID | 136623433 |
| Molecular Formula | C12H8ClN3OS2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1sccc1-c1cc(=O)[nH]c(-c2nc(Cl)cs2)n1 |
| InChI | InChI=1S/C12H8ClN3OS2/c1-6-7(2-3-18-6)8-4-10(17)16-11(14-8)12-15-9(13)5-19-12/h2-5H,1H3,(H,14,16,17) |
| InChIKey | CSLYGSUSKCJDIK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one?
The IUPAC name of 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one (CID 136623433) is 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one is Cc1sccc1-c1cc(=O)[nH]c(-c2nc(Cl)cs2)n1.
What is the InChIKey of 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one?
The InChIKey is CSLYGSUSKCJDIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN3OS2/c1-6-7(2-3-18-6)8-4-10(17)16-11(14-8)12-15-9(13)5-19-12/h2-5H,1H3,(H,14,16,17).
What are the key properties of 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one?
2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one has a molecular weight of 309.80 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-1,3-thiazol-2-yl)-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136623433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).