About 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one
2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one (PubChem CID 136623438) has the molecular formula C12H10ClN5OS
and a molecular weight of 307.77 g/mol. Its IUPAC name is 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one |
| PubChem CID | 136623438 |
| Molecular Formula | C12H10ClN5OS |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one |
| SMILES | CCn1cc(-c2cc(=O)[nH]c(-c3nc(Cl)cs3)n2)cn1 |
| InChI | InChI=1S/C12H10ClN5OS/c1-2-18-5-7(4-14-18)8-3-10(19)17-11(15-8)12-16-9(13)6-20-12/h3-6H,2H2,1H3,(H,15,17,19) |
| InChIKey | METUCALAYVKPLL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one?
The IUPAC name of 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one (CID 136623438) is 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one is CCn1cc(-c2cc(=O)[nH]c(-c3nc(Cl)cs3)n2)cn1.
What is the InChIKey of 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one?
The InChIKey is METUCALAYVKPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN5OS/c1-2-18-5-7(4-14-18)8-3-10(19)17-11(15-8)12-16-9(13)6-20-12/h3-6H,2H2,1H3,(H,15,17,19).
What are the key properties of 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one?
2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one has a molecular weight of 307.77 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-1,3-thiazol-2-yl)-4-(1-ethylpyrazol-4-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136623438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).