C21H16FN3O3 — CID 136625720
3-[2-(4-fluorophenyl)ethenyl]-N-(furan-2-ylmethyl)-4-hydroxy-1H-indazole-5-carboxamide (PubChem CID 136625720) has the molecular formula C21H16FN3O3 and a molecular weight of 377.38 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)ethenyl]-N-(furan-2-ylmethyl)-4-hydroxy-1H-indazole-5-carboxamide.
| Compound Name | 3-[2-(4-fluorophenyl)ethenyl]-N-(furan-2-ylmethyl)-4-hydroxy-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 136625720 |
| Molecular Formula | C21H16FN3O3 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-[2-(4-fluorophenyl)ethenyl]-N-(furan-2-ylmethyl)-4-hydroxy-1H-indazole-5-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc2[nH]nc(C=Cc3ccc(F)cc3)c2c1O |
| InChI | InChI=1S/C21H16FN3O3/c22-14-6-3-13(4-7-14)5-9-17-19-18(25-24-17)10-8-16(20(19)26)21(27)23-12-15-2-1-11-28-15/h1-11,26H,12H2,(H,23,27)(H,24,25) |
| InChIKey | SLMDAPBZXOXCRC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |