C11H22ClN3O3S — CID 136626119
(3aR,5R,6S,7R,7aR)-5-(ethylaminomethyl)-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol;hydrochloride (PubChem CID 136626119) has the molecular formula C11H22ClN3O3S and a molecular weight of 311.84 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-5-(ethylaminomethyl)-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol;hydrochloride.
| Compound Name | (3aR,5R,6S,7R,7aR)-5-(ethylaminomethyl)-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol;hydrochloride |
|---|---|
| PubChem CID | 136626119 |
| Molecular Formula | C11H22ClN3O3S |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-5-(ethylaminomethyl)-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol;hydrochloride |
| SMILES | CC/N=C1/N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CNCC)O[C@@H]2S1.Cl |
| InChI | InChI=1S/C11H21N3O3S.ClH/c1-3-12-5-6-8(15)9(16)7-10(17-6)18-11(14-7)13-4-2;/h6-10,12,15-16H,3-5H2,1-2H3,(H,13,14);1H/t6-,7-,8-,9-,10-;/m1./s1 |
| InChIKey | PYZLDWJODXBIQC-NZKIOLFWSA-N |
| XLogP | -0.45 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|