C23H20FN7O — CID 136626676
8-(4-fluoro-2-methylphenyl)-2-[5-(4-methylimidazol-1-yl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine (PubChem CID 136626676) has the molecular formula C23H20FN7O and a molecular weight of 429.46 g/mol. Its IUPAC name is 8-(4-fluoro-2-methylphenyl)-2-[5-(4-methylimidazol-1-yl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine.
| Compound Name | 8-(4-fluoro-2-methylphenyl)-2-[5-(4-methylimidazol-1-yl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 136626676 |
| Molecular Formula | C23H20FN7O |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 8-(4-fluoro-2-methylphenyl)-2-[5-(4-methylimidazol-1-yl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine |
| SMILES | Cc1cn(-c2ccc3[nH]c(-c4nc5n(n4)CCOC5c4ccc(F)cc4C)cc3n2)cn1 |
| InChI | InChI=1S/C23H20FN7O/c1-13-9-15(24)3-4-16(13)21-23-28-22(29-31(23)7-8-32-21)19-10-18-17(26-19)5-6-20(27-18)30-11-14(2)25-12-30/h3-6,9-12,21,26H,7-8H2,1-2H3 |
| InChIKey | RJLRLFGYTHYZOF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |