C21H18N6 — CID 136627179
2-[8-(2-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1H-pyrrolo[2,3-c]pyridine-5-carbonitrile (PubChem CID 136627179) has the molecular formula C21H18N6 and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-[8-(2-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1H-pyrrolo[2,3-c]pyridine-5-carbonitrile.
| Compound Name | 2-[8-(2-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1H-pyrrolo[2,3-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 136627179 |
| Molecular Formula | C21H18N6 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[8-(2-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1H-pyrrolo[2,3-c]pyridine-5-carbonitrile |
| SMILES | Cc1ccccc1C1CCCn2nc(-c3cc4cc(C#N)ncc4[nH]3)nc21 |
| InChI | InChI=1S/C21H18N6/c1-13-5-2-3-6-16(13)17-7-4-8-27-21(17)25-20(26-27)18-10-14-9-15(11-22)23-12-19(14)24-18/h2-3,5-6,9-10,12,17,24H,4,7-8H2,1H3 |
| InChIKey | XXQZGTWABSIQEL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |