C19H37N6O2+ — CID 136627686
5-(dimethylamino)pentyl-methyl-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyl]-propylazanium (PubChem CID 136627686) has the molecular formula C19H37N6O2+ and a molecular weight of 381.55 g/mol. Its IUPAC name is 5-(dimethylamino)pentyl-methyl-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyl]-propylazanium.
| Compound Name | 5-(dimethylamino)pentyl-methyl-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyl]-propylazanium |
|---|---|
| PubChem CID | 136627686 |
| Molecular Formula | C19H37N6O2+ |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | 5-(dimethylamino)pentyl-methyl-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyl]-propylazanium |
| SMILES | CCC[N+](C)(CCCCCN(C)C)CCNC(=O)Nc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C19H36N6O2/c1-6-12-25(5,13-9-7-8-11-24(3)4)14-10-20-19(27)23-18-21-16(2)15-17(26)22-18/h15H,6-14H2,1-5H3,(H2-,20,21,22,23,26,27)/p+1 |
| InChIKey | OBXYOPYPTURYNT-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|