C10H11N7O2 — CID 136627849
6-[(E)-methoxyiminomethyl]-4-[(E)-pyrimidin-5-ylmethylideneamino]-2,5-dihydro-1,2,4-triazin-3-one (PubChem CID 136627849) has the molecular formula C10H11N7O2 and a molecular weight of 261.25 g/mol. Its IUPAC name is 6-[(E)-methoxyiminomethyl]-4-[(E)-pyrimidin-5-ylmethylideneamino]-2,5-dihydro-1,2,4-triazin-3-one.
| Compound Name | 6-[(E)-methoxyiminomethyl]-4-[(E)-pyrimidin-5-ylmethylideneamino]-2,5-dihydro-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 136627849 |
| Molecular Formula | C10H11N7O2 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-[(E)-methoxyiminomethyl]-4-[(E)-pyrimidin-5-ylmethylideneamino]-2,5-dihydro-1,2,4-triazin-3-one |
| SMILES | CO/N=C/C1=NNC(=O)N(/N=C/c2cncnc2)C1 |
| InChI | InChI=1S/C10H11N7O2/c1-19-14-5-9-6-17(10(18)16-15-9)13-4-8-2-11-7-12-3-8/h2-5,7H,6H2,1H3,(H,16,18)/b13-4+,14-5+ |
| InChIKey | PPRPYRJIHWCORB-PCSLFHOQSA-N |
| XLogP | -0.18 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|