C26H30F3N3O2S — CID 136628095
N-[[4-[[[(3aR,9bS)-7,8-difluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide (PubChem CID 136628095) has the molecular formula C26H30F3N3O2S and a molecular weight of 505.61 g/mol. Its IUPAC name is N-[[4-[[[(3aR,9bS)-7,8-difluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[[4-[[[(3aR,9bS)-7,8-difluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 136628095 |
| Molecular Formula | C26H30F3N3O2S |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[[4-[[[(3aR,9bS)-7,8-difluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(C/N=C2\C[C@H]3c4cc(F)c(F)cc4CC[C@H]3N2)CC1)c1ccccc1F |
| InChI | InChI=1S/C26H30F3N3O2S/c27-21-3-1-2-4-25(21)35(33,34)31-15-17-7-5-16(6-8-17)14-30-26-13-20-19-12-23(29)22(28)11-18(19)9-10-24(20)32-26/h1-4,11-12,16-17,20,24,31H,5-10,13-15H2,(H,30,32)/t16?,17?,20-,24+/m0/s1 |
| InChIKey | AZKJHYRYNKBPQQ-AXSXPWBOSA-N |
| XLogP | 4.68 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|