C21H21ClN6O5S — CID 136628705
10'-chloro-9'-hydroxy-2',4'-dimethyl-8'-(4-methyl-1,3-thiazole-2-carboximidoyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-2,4,6-trione (PubChem CID 136628705) has the molecular formula C21H21ClN6O5S and a molecular weight of 504.96 g/mol. Its IUPAC name is 10'-chloro-9'-hydroxy-2',4'-dimethyl-8'-(4-methyl-1,3-thiazole-2-carboximidoyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-2,4,6-trione.
| Compound Name | 10'-chloro-9'-hydroxy-2',4'-dimethyl-8'-(4-methyl-1,3-thiazole-2-carboximidoyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 136628705 |
| Molecular Formula | C21H21ClN6O5S |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 10'-chloro-9'-hydroxy-2',4'-dimethyl-8'-(4-methyl-1,3-thiazole-2-carboximidoyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-2,4,6-trione |
| SMILES | [H]/N=C(\c1nc(C)cs1)c1nc2c(c(Cl)c1O)N1CC(C)OC(C)C1C1(C2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C21H21ClN6O5S/c1-7-6-34-17(24-7)12(23)13-15(29)11(22)14-10(25-13)4-21(18(30)26-20(32)27-19(21)31)16-9(3)33-8(2)5-28(14)16/h6,8-9,16,23,29H,4-5H2,1-3H3,(H2,26,27,30,31,32)/b23-12- |
| InChIKey | BFESNFUZICAEPX-FMCGGJTJSA-N |
| XLogP | 1.51 |
| TPSA | 157.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|