About 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one
5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one (PubChem CID 136628763) has the molecular formula C16H10Cl2FN3O2S
and a molecular weight of 398.25 g/mol. Its IUPAC name is 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one |
| PubChem CID | 136628763 |
| Molecular Formula | C16H10Cl2FN3O2S |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one |
| SMILES | [H]/N=C/c1c(Nc2ccc(Oc3ccc(F)cc3Cl)c(Cl)c2)s[nH]c1=O |
| InChI | InChI=1S/C16H10Cl2FN3O2S/c17-11-5-8(19)1-3-13(11)24-14-4-2-9(6-12(14)18)21-16-10(7-20)15(23)22-25-16/h1-7,20-21H,(H,22,23)/b20-7+ |
| InChIKey | YFETZMLHFOKZGC-IFRROFPPSA-N |
| XLogP | 5.42 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one?
The IUPAC name of 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one (CID 136628763) is 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one.
What is the SMILES notation for 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one?
The canonical SMILES for 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one is [H]/N=C/c1c(Nc2ccc(Oc3ccc(F)cc3Cl)c(Cl)c2)s[nH]c1=O.
What is the InChIKey of 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one?
The InChIKey is YFETZMLHFOKZGC-IFRROFPPSA-N. The full InChI is InChI=1S/C16H10Cl2FN3O2S/c17-11-5-8(19)1-3-13(11)24-14-4-2-9(6-12(14)18)21-16-10(7-20)15(23)22-25-16/h1-7,20-21H,(H,22,23)/b20-7+.
What are the key properties of 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one?
5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one has a molecular weight of 398.25 g/mol, XLogP of 5.42, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-chloro-4-(2-chloro-4-fluorophenoxy)anilino]-4-methanimidoyl-1,2-thiazol-3-one is sourced from PubChem (CID 136628763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).