C20H21F3N4O5S — CID 136629136
benzyl (2S)-2-[5-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carboxylate (PubChem CID 136629136) has the molecular formula C20H21F3N4O5S and a molecular weight of 486.47 g/mol. Its IUPAC name is benzyl (2S)-2-[5-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[5-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 136629136 |
| Molecular Formula | C20H21F3N4O5S |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | benzyl (2S)-2-[5-(trifluoromethylsulfonyloxy)-4,5-dihydropyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC[C@H]1c1cc2n(n1)C=CC(OS(=O)(=O)C(F)(F)F)N2 |
| InChI | InChI=1S/C20H21F3N4O5S/c21-20(22,23)33(29,30)32-18-9-11-27-17(24-18)12-15(25-27)16-8-4-5-10-26(16)19(28)31-13-14-6-2-1-3-7-14/h1-3,6-7,9,11-12,16,18,24H,4-5,8,10,13H2/t16-,18?/m0/s1 |
| InChIKey | KUMRAXDSKWZPHK-ATNAJCNCSA-N |
| XLogP | 3.84 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|