C21H24BN5O4 — CID 136629678
CID 136629678 (PubChem CID 136629678) has the molecular formula C21H24BN5O4 and a molecular weight of 421.27 g/mol.
| Compound Name | CID 136629678 |
|---|---|
| PubChem CID | 136629678 |
| Molecular Formula | C21H24BN5O4 |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2oc3c(=O)[nH]c(CN4C[C@@H](O)[C@H](NC(=O)C5CCNCC5)C4)nc3c2c1 |
| InChI | InChI=1S/C21H24BN5O4/c22-12-1-2-16-13(7-12)18-19(31-16)21(30)26-17(25-18)10-27-8-14(15(28)9-27)24-20(29)11-3-5-23-6-4-11/h1-2,7,11,14-15,23,28H,3-6,8-10H2,(H,24,29)(H,25,26,30)/t14-,15-/m1/s1 |
| InChIKey | BBEFXGBGHPFCNQ-HUUCEWRRSA-N |
| XLogP | -0.88 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|