C36H49N3O2 — CID 136630201
2-[4,6-bis(2,3,4,5,6-pentamethylphenyl)-1,3,5-triazin-2-yl]-5-methoxyphenol;ethane (PubChem CID 136630201) has the molecular formula C36H49N3O2 and a molecular weight of 555.81 g/mol. Its IUPAC name is 2-[4,6-bis(2,3,4,5,6-pentamethylphenyl)-1,3,5-triazin-2-yl]-5-methoxyphenol;ethane.
| Compound Name | 2-[4,6-bis(2,3,4,5,6-pentamethylphenyl)-1,3,5-triazin-2-yl]-5-methoxyphenol;ethane |
|---|---|
| PubChem CID | 136630201 |
| Molecular Formula | C36H49N3O2 |
| Molecular Weight | 555.81 g/mol |
| Exact Mass | 555.38 |
| IUPAC Name | 2-[4,6-bis(2,3,4,5,6-pentamethylphenyl)-1,3,5-triazin-2-yl]-5-methoxyphenol;ethane |
| SMILES | CC.CC.COc1ccc(-c2nc(-c3c(C)c(C)c(C)c(C)c3C)nc(-c3c(C)c(C)c(C)c(C)c3C)n2)c(O)c1 |
| InChI | InChI=1S/C32H37N3O2.2C2H6/c1-15-17(3)21(7)28(22(8)18(15)4)31-33-30(26-13-12-25(37-11)14-27(26)36)34-32(35-31)29-23(9)19(5)16(2)20(6)24(29)10;2*1-2/h12-14,36H,1-11H3;2*1-2H3 |
| InChIKey | WNNUZYQMOJTCPR-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.81 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |