C19H21N5O2 — CID 136631475
tert-butyl 5-(5,7,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 136631475) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is tert-butyl 5-(5,7,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-(5,7,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 136631475 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | tert-butyl 5-(5,7,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC=C(c2cc[nH]c3nnc4nccc4c23)C1 |
| InChI | InChI=1S/C19H21N5O2/c1-19(2,3)26-18(25)24-10-4-5-12(11-24)13-6-8-21-17-15(13)14-7-9-20-16(14)22-23-17/h5-9H,4,10-11H2,1-3H3,(H,21,23) |
| InChIKey | VKNCDZUZHCGDKU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |