C12H8FN3O — CID 136633225
2-(4-fluorophenyl)-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 136633225) has the molecular formula C12H8FN3O and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-(4-fluorophenyl)-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 136633225 |
| Molecular Formula | C12H8FN3O |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(4-fluorophenyl)-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(F)cc2)nn2cccc12 |
| InChI | InChI=1S/C12H8FN3O/c13-9-5-3-8(4-6-9)11-14-12(17)10-2-1-7-16(10)15-11/h1-7H,(H,14,15,17) |
| InChIKey | SMWDHIZANHNSBQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |