C14H20F2N4O2 — CID 136633617
6-(difluoromethyl)-1-hexyl-3-methyl-4,7-dihydropyrimido[5,4-d]pyrimidine-2,8-dione (PubChem CID 136633617) has the molecular formula C14H20F2N4O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 6-(difluoromethyl)-1-hexyl-3-methyl-4,7-dihydropyrimido[5,4-d]pyrimidine-2,8-dione.
| Compound Name | 6-(difluoromethyl)-1-hexyl-3-methyl-4,7-dihydropyrimido[5,4-d]pyrimidine-2,8-dione |
|---|---|
| PubChem CID | 136633617 |
| Molecular Formula | C14H20F2N4O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 6-(difluoromethyl)-1-hexyl-3-methyl-4,7-dihydropyrimido[5,4-d]pyrimidine-2,8-dione |
| SMILES | CCCCCCN1C(=O)N(C)Cc2nc(C(F)F)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H20F2N4O2/c1-3-4-5-6-7-20-10-9(8-19(2)14(20)22)17-12(11(15)16)18-13(10)21/h11H,3-8H2,1-2H3,(H,17,18,21) |
| InChIKey | RBVSWBLJCOFWNX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|