C14H17ClN4O2 — CID 136633861
3-(6-chlorohex-1-ynyl)-5-(2-methoxyethyl)-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one (PubChem CID 136633861) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 3-(6-chlorohex-1-ynyl)-5-(2-methoxyethyl)-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one.
| Compound Name | 3-(6-chlorohex-1-ynyl)-5-(2-methoxyethyl)-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 136633861 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-(6-chlorohex-1-ynyl)-5-(2-methoxyethyl)-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one |
| SMILES | COCCc1nc2c(C#CCCCCCl)[nH]nc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H17ClN4O2/c1-21-9-7-11-16-12-10(6-4-2-3-5-8-15)18-19-13(12)14(20)17-11/h2-3,5,7-9H2,1H3,(H,18,19)(H,16,17,20) |
| InChIKey | ZJDAKFSSRVESFC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|